C22H28ClN5O2 — CID 4310467
N-butyl-4-[4-[(4-chlorophenyl)carbamoylamino]phenyl]piperazine-1-carboxamide (PubChem CID 4310467) has the molecular formula C22H28ClN5O2 and a molecular weight of 429.95 g/mol. Its IUPAC name is N-butyl-4-[4-[(4-chlorophenyl)carbamoylamino]phenyl]piperazine-1-carboxamide.
| Compound Name | N-butyl-4-[4-[(4-chlorophenyl)carbamoylamino]phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 4310467 |
| Molecular Formula | C22H28ClN5O2 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | N-butyl-4-[4-[(4-chlorophenyl)carbamoylamino]phenyl]piperazine-1-carboxamide |
| SMILES | CCCCNC(=O)N1CCN(c2ccc(NC(=O)Nc3ccc(Cl)cc3)cc2)CC1 |
| InChI | InChI=1S/C22H28ClN5O2/c1-2-3-12-24-22(30)28-15-13-27(14-16-28)20-10-8-19(9-11-20)26-21(29)25-18-6-4-17(23)5-7-18/h4-11H,2-3,12-16H2,1H3,(H,24,30)(H2,25,26,29) |
| InChIKey | WSUUFJWGVVQQRV-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|