C22H28BrN5O2 — CID 42767278
4-[4-[(3-bromophenyl)carbamoylamino]phenyl]-N-butylpiperazine-1-carboxamide (PubChem CID 42767278) has the molecular formula C22H28BrN5O2 and a molecular weight of 474.40 g/mol. Its IUPAC name is 4-[4-[(3-bromophenyl)carbamoylamino]phenyl]-N-butylpiperazine-1-carboxamide.
| Compound Name | 4-[4-[(3-bromophenyl)carbamoylamino]phenyl]-N-butylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 42767278 |
| Molecular Formula | C22H28BrN5O2 |
| Molecular Weight | 474.40 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 4-[4-[(3-bromophenyl)carbamoylamino]phenyl]-N-butylpiperazine-1-carboxamide |
| SMILES | CCCCNC(=O)N1CCN(c2ccc(NC(=O)Nc3cccc(Br)c3)cc2)CC1 |
| InChI | InChI=1S/C22H28BrN5O2/c1-2-3-11-24-22(30)28-14-12-27(13-15-28)20-9-7-18(8-10-20)25-21(29)26-19-6-4-5-17(23)16-19/h4-10,16H,2-3,11-15H2,1H3,(H,24,30)(H2,25,26,29) |
| InChIKey | RMCCLJIJXVDFDL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.40 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|