C24H33N5O4 — CID 3970845
N-butyl-4-[4-[(3,5-dimethoxyphenyl)carbamoylamino]phenyl]piperazine-1-carboxamide (PubChem CID 3970845) has the molecular formula C24H33N5O4 and a molecular weight of 455.56 g/mol. Its IUPAC name is N-butyl-4-[4-[(3,5-dimethoxyphenyl)carbamoylamino]phenyl]piperazine-1-carboxamide.
| Compound Name | N-butyl-4-[4-[(3,5-dimethoxyphenyl)carbamoylamino]phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 3970845 |
| Molecular Formula | C24H33N5O4 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | N-butyl-4-[4-[(3,5-dimethoxyphenyl)carbamoylamino]phenyl]piperazine-1-carboxamide |
| SMILES | CCCCNC(=O)N1CCN(c2ccc(NC(=O)Nc3cc(OC)cc(OC)c3)cc2)CC1 |
| InChI | InChI=1S/C24H33N5O4/c1-4-5-10-25-24(31)29-13-11-28(12-14-29)20-8-6-18(7-9-20)26-23(30)27-19-15-21(32-2)17-22(16-19)33-3/h6-9,15-17H,4-5,10-14H2,1-3H3,(H,25,31)(H2,26,27,30) |
| InChIKey | KOLNKEAKAUXVNC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|