C25H34N4O4 — CID 3537073
1-(2,4-dimethoxyphenyl)-3-[4-(4-hexanoylpiperazin-1-yl)phenyl]urea (PubChem CID 3537073) has the molecular formula C25H34N4O4 and a molecular weight of 454.57 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-3-[4-(4-hexanoylpiperazin-1-yl)phenyl]urea.
| Compound Name | 1-(2,4-dimethoxyphenyl)-3-[4-(4-hexanoylpiperazin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 3537073 |
| Molecular Formula | C25H34N4O4 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-3-[4-(4-hexanoylpiperazin-1-yl)phenyl]urea |
| SMILES | CCCCCC(=O)N1CCN(c2ccc(NC(=O)Nc3ccc(OC)cc3OC)cc2)CC1 |
| InChI | InChI=1S/C25H34N4O4/c1-4-5-6-7-24(30)29-16-14-28(15-17-29)20-10-8-19(9-11-20)26-25(31)27-22-13-12-21(32-2)18-23(22)33-3/h8-13,18H,4-7,14-17H2,1-3H3,(H2,26,27,31) |
| InChIKey | RXAICGNSDUXCPX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|