C27H30N4O4 — CID 1056825
1-(2,4-dimethoxyphenyl)-3-[4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]urea (PubChem CID 1056825) has the molecular formula C27H30N4O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-3-[4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]urea.
| Compound Name | 1-(2,4-dimethoxyphenyl)-3-[4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]urea |
|---|---|
| PubChem CID | 1056825 |
| Molecular Formula | C27H30N4O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-3-[4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]urea |
| SMILES | COc1ccc(NC(=O)Nc2ccc(N3CCN(C(=O)c4ccccc4C)CC3)cc2)c(OC)c1 |
| InChI | InChI=1S/C27H30N4O4/c1-19-6-4-5-7-23(19)26(32)31-16-14-30(15-17-31)21-10-8-20(9-11-21)28-27(33)29-24-13-12-22(34-2)18-25(24)35-3/h4-13,18H,14-17H2,1-3H3,(H2,28,29,33) |
| InChIKey | HKEUQZRCMZLRRQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|