C32H39N5O5 — CID 1064665
1-(2,4-dimethoxyphenyl)-3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(piperidine-1-carbonyl)phenyl]urea (PubChem CID 1064665) has the molecular formula C32H39N5O5 and a molecular weight of 573.69 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(piperidine-1-carbonyl)phenyl]urea.
| Compound Name | 1-(2,4-dimethoxyphenyl)-3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(piperidine-1-carbonyl)phenyl]urea |
|---|---|
| PubChem CID | 1064665 |
| Molecular Formula | C32H39N5O5 |
| Molecular Weight | 573.69 g/mol |
| Exact Mass | 573.30 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(piperidine-1-carbonyl)phenyl]urea |
| SMILES | COc1ccc(NC(=O)Nc2ccc(N3CCN(c4ccccc4OC)CC3)c(C(=O)N3CCCCC3)c2)c(OC)c1 |
| InChI | InChI=1S/C32H39N5O5/c1-40-24-12-13-26(30(22-24)42-3)34-32(39)33-23-11-14-27(25(21-23)31(38)37-15-7-4-8-16-37)35-17-19-36(20-18-35)28-9-5-6-10-29(28)41-2/h5-6,9-14,21-22H,4,7-8,15-20H2,1-3H3,(H2,33,34,39) |
| InChIKey | COHYWGSFRNGPCG-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 95.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.69 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|