C27H35N3O4 — CID 1063866
2,4-dimethoxy-N-[4-(4-methylpiperidin-1-yl)-3-(piperidine-1-carbonyl)phenyl]benzamide (PubChem CID 1063866) has the molecular formula C27H35N3O4 and a molecular weight of 465.59 g/mol. Its IUPAC name is 2,4-dimethoxy-N-[4-(4-methylpiperidin-1-yl)-3-(piperidine-1-carbonyl)phenyl]benzamide.
| Compound Name | 2,4-dimethoxy-N-[4-(4-methylpiperidin-1-yl)-3-(piperidine-1-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 1063866 |
| Molecular Formula | C27H35N3O4 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | 2,4-dimethoxy-N-[4-(4-methylpiperidin-1-yl)-3-(piperidine-1-carbonyl)phenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(N3CCC(C)CC3)c(C(=O)N3CCCCC3)c2)c(OC)c1 |
| InChI | InChI=1S/C27H35N3O4/c1-19-11-15-29(16-12-19)24-10-7-20(17-23(24)27(32)30-13-5-4-6-14-30)28-26(31)22-9-8-21(33-2)18-25(22)34-3/h7-10,17-19H,4-6,11-16H2,1-3H3,(H,28,31) |
| InChIKey | SISCCABTSWVDMB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|