C28H37N3O4 — CID 3643543
N-cyclohexyl-5-[(2,4-dimethoxybenzoyl)amino]-2-(4-methylpiperidin-1-yl)benzamide (PubChem CID 3643543) has the molecular formula C28H37N3O4 and a molecular weight of 479.62 g/mol. Its IUPAC name is N-cyclohexyl-5-[(2,4-dimethoxybenzoyl)amino]-2-(4-methylpiperidin-1-yl)benzamide.
| Compound Name | N-cyclohexyl-5-[(2,4-dimethoxybenzoyl)amino]-2-(4-methylpiperidin-1-yl)benzamide |
|---|---|
| PubChem CID | 3643543 |
| Molecular Formula | C28H37N3O4 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.28 |
| IUPAC Name | N-cyclohexyl-5-[(2,4-dimethoxybenzoyl)amino]-2-(4-methylpiperidin-1-yl)benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(N3CCC(C)CC3)c(C(=O)NC3CCCCC3)c2)c(OC)c1 |
| InChI | InChI=1S/C28H37N3O4/c1-19-13-15-31(16-14-19)25-12-9-21(17-24(25)28(33)29-20-7-5-4-6-8-20)30-27(32)23-11-10-22(34-2)18-26(23)35-3/h9-12,17-20H,4-8,13-16H2,1-3H3,(H,29,33)(H,30,32) |
| InChIKey | WWMYWCVNYRXETP-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|