C27H35N3O3 — CID 4313980
5-[(4-butoxybenzoyl)amino]-N-cyclopropyl-2-(4-methylpiperidin-1-yl)benzamide (PubChem CID 4313980) has the molecular formula C27H35N3O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is 5-[(4-butoxybenzoyl)amino]-N-cyclopropyl-2-(4-methylpiperidin-1-yl)benzamide.
| Compound Name | 5-[(4-butoxybenzoyl)amino]-N-cyclopropyl-2-(4-methylpiperidin-1-yl)benzamide |
|---|---|
| PubChem CID | 4313980 |
| Molecular Formula | C27H35N3O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | 5-[(4-butoxybenzoyl)amino]-N-cyclopropyl-2-(4-methylpiperidin-1-yl)benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccc(N3CCC(C)CC3)c(C(=O)NC3CC3)c2)cc1 |
| InChI | InChI=1S/C27H35N3O3/c1-3-4-17-33-23-10-5-20(6-11-23)26(31)29-22-9-12-25(30-15-13-19(2)14-16-30)24(18-22)27(32)28-21-7-8-21/h5-6,9-12,18-19,21H,3-4,7-8,13-17H2,1-2H3,(H,28,32)(H,29,31) |
| InChIKey | LHZWZMRUKRLPQW-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|