C28H40N4O3 — CID 3612260
5-[(4-butoxybenzoyl)amino]-N-[3-(dimethylamino)propyl]-2-piperidin-1-ylbenzamide (PubChem CID 3612260) has the molecular formula C28H40N4O3 and a molecular weight of 480.65 g/mol. Its IUPAC name is 5-[(4-butoxybenzoyl)amino]-N-[3-(dimethylamino)propyl]-2-piperidin-1-ylbenzamide.
| Compound Name | 5-[(4-butoxybenzoyl)amino]-N-[3-(dimethylamino)propyl]-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 3612260 |
| Molecular Formula | C28H40N4O3 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | 5-[(4-butoxybenzoyl)amino]-N-[3-(dimethylamino)propyl]-2-piperidin-1-ylbenzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccc(N3CCCCC3)c(C(=O)NCCCN(C)C)c2)cc1 |
| InChI | InChI=1S/C28H40N4O3/c1-4-5-20-35-24-13-10-22(11-14-24)27(33)30-23-12-15-26(32-18-7-6-8-19-32)25(21-23)28(34)29-16-9-17-31(2)3/h10-15,21H,4-9,16-20H2,1-3H3,(H,29,34)(H,30,33) |
| InChIKey | MBMSDNFGZQXZPG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|