C22H30N4O3 — CID 42757063
N-[3-[3-(dimethylamino)propylcarbamoyl]-4-piperidin-1-ylphenyl]furan-2-carboxamide (PubChem CID 42757063) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is N-[3-[3-(dimethylamino)propylcarbamoyl]-4-piperidin-1-ylphenyl]furan-2-carboxamide.
| Compound Name | N-[3-[3-(dimethylamino)propylcarbamoyl]-4-piperidin-1-ylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42757063 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | N-[3-[3-(dimethylamino)propylcarbamoyl]-4-piperidin-1-ylphenyl]furan-2-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1cc(NC(=O)c2ccco2)ccc1N1CCCCC1 |
| InChI | InChI=1S/C22H30N4O3/c1-25(2)12-7-11-23-21(27)18-16-17(24-22(28)20-8-6-15-29-20)9-10-19(18)26-13-4-3-5-14-26/h6,8-10,15-16H,3-5,7,11-14H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | SFVVCNAAUFUQJA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|