C27H31N3O4 — CID 4042183
N-[4-(4-benzylpiperidin-1-yl)-3-(2-methoxyethylcarbamoyl)phenyl]furan-2-carboxamide (PubChem CID 4042183) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is N-[4-(4-benzylpiperidin-1-yl)-3-(2-methoxyethylcarbamoyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[4-(4-benzylpiperidin-1-yl)-3-(2-methoxyethylcarbamoyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 4042183 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | N-[4-(4-benzylpiperidin-1-yl)-3-(2-methoxyethylcarbamoyl)phenyl]furan-2-carboxamide |
| SMILES | COCCNC(=O)c1cc(NC(=O)c2ccco2)ccc1N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H31N3O4/c1-33-17-13-28-26(31)23-19-22(29-27(32)25-8-5-16-34-25)9-10-24(23)30-14-11-21(12-15-30)18-20-6-3-2-4-7-20/h2-10,16,19,21H,11-15,17-18H2,1H3,(H,28,31)(H,29,32) |
| InChIKey | GDHDPTBSZHPAJS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|