C28H39N3O3 — CID 3313553
2-(4-benzylpiperidin-1-yl)-N-(3-ethoxypropyl)-5-(2-methylpropanoylamino)benzamide (PubChem CID 3313553) has the molecular formula C28H39N3O3 and a molecular weight of 465.64 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-N-(3-ethoxypropyl)-5-(2-methylpropanoylamino)benzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-N-(3-ethoxypropyl)-5-(2-methylpropanoylamino)benzamide |
|---|---|
| PubChem CID | 3313553 |
| Molecular Formula | C28H39N3O3 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.30 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-N-(3-ethoxypropyl)-5-(2-methylpropanoylamino)benzamide |
| SMILES | CCOCCCNC(=O)c1cc(NC(=O)C(C)C)ccc1N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C28H39N3O3/c1-4-34-18-8-15-29-28(33)25-20-24(30-27(32)21(2)3)11-12-26(25)31-16-13-23(14-17-31)19-22-9-6-5-7-10-22/h5-7,9-12,20-21,23H,4,8,13-19H2,1-3H3,(H,29,33)(H,30,32) |
| InChIKey | XNAMZTVEPRNICZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|