C35H45N3O4 — CID 3371890
2-(4-benzylpiperidin-1-yl)-5-[(4-butoxybenzoyl)amino]-N-(3-ethoxypropyl)benzamide (PubChem CID 3371890) has the molecular formula C35H45N3O4 and a molecular weight of 571.76 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-5-[(4-butoxybenzoyl)amino]-N-(3-ethoxypropyl)benzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-5-[(4-butoxybenzoyl)amino]-N-(3-ethoxypropyl)benzamide |
|---|---|
| PubChem CID | 3371890 |
| Molecular Formula | C35H45N3O4 |
| Molecular Weight | 571.76 g/mol |
| Exact Mass | 571.34 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-5-[(4-butoxybenzoyl)amino]-N-(3-ethoxypropyl)benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccc(N3CCC(Cc4ccccc4)CC3)c(C(=O)NCCCOCC)c2)cc1 |
| InChI | InChI=1S/C35H45N3O4/c1-3-5-24-42-31-15-12-29(13-16-31)34(39)37-30-14-17-33(32(26-30)35(40)36-20-9-23-41-4-2)38-21-18-28(19-22-38)25-27-10-7-6-8-11-27/h6-8,10-17,26,28H,3-5,9,18-25H2,1-2H3,(H,36,40)(H,37,39) |
| InChIKey | CBFNRFNZFBCZQT-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.76 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|