C31H43N3O3 — CID 4286420
2-(4-benzylpiperidin-1-yl)-5-(cyclohexanecarbonylamino)-N-(3-ethoxypropyl)benzamide (PubChem CID 4286420) has the molecular formula C31H43N3O3 and a molecular weight of 505.70 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-5-(cyclohexanecarbonylamino)-N-(3-ethoxypropyl)benzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-5-(cyclohexanecarbonylamino)-N-(3-ethoxypropyl)benzamide |
|---|---|
| PubChem CID | 4286420 |
| Molecular Formula | C31H43N3O3 |
| Molecular Weight | 505.70 g/mol |
| Exact Mass | 505.33 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-5-(cyclohexanecarbonylamino)-N-(3-ethoxypropyl)benzamide |
| SMILES | CCOCCCNC(=O)c1cc(NC(=O)C2CCCCC2)ccc1N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C31H43N3O3/c1-2-37-21-9-18-32-31(36)28-23-27(33-30(35)26-12-7-4-8-13-26)14-15-29(28)34-19-16-25(17-20-34)22-24-10-5-3-6-11-24/h3,5-6,10-11,14-15,23,25-26H,2,4,7-9,12-13,16-22H2,1H3,(H,32,36)(H,33,35) |
| InChIKey | UWESOAWBNAUZHF-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.70 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|