C29H35N3O4 — CID 42757286
N-[4-(4-benzylpiperidin-1-yl)-3-(3-ethoxypropylcarbamoyl)phenyl]furan-2-carboxamide (PubChem CID 42757286) has the molecular formula C29H35N3O4 and a molecular weight of 489.62 g/mol. Its IUPAC name is N-[4-(4-benzylpiperidin-1-yl)-3-(3-ethoxypropylcarbamoyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[4-(4-benzylpiperidin-1-yl)-3-(3-ethoxypropylcarbamoyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42757286 |
| Molecular Formula | C29H35N3O4 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | N-[4-(4-benzylpiperidin-1-yl)-3-(3-ethoxypropylcarbamoyl)phenyl]furan-2-carboxamide |
| SMILES | CCOCCCNC(=O)c1cc(NC(=O)c2ccco2)ccc1N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C29H35N3O4/c1-2-35-18-7-15-30-28(33)25-21-24(31-29(34)27-10-6-19-36-27)11-12-26(25)32-16-13-23(14-17-32)20-22-8-4-3-5-9-22/h3-6,8-12,19,21,23H,2,7,13-18,20H2,1H3,(H,30,33)(H,31,34) |
| InChIKey | APAYIYHTKSUIDR-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|