C32H39N3O3 — CID 4261431
2-(4-benzylpiperidin-1-yl)-N-(3-ethoxypropyl)-5-[(2-phenylacetyl)amino]benzamide (PubChem CID 4261431) has the molecular formula C32H39N3O3 and a molecular weight of 513.68 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-N-(3-ethoxypropyl)-5-[(2-phenylacetyl)amino]benzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-N-(3-ethoxypropyl)-5-[(2-phenylacetyl)amino]benzamide |
|---|---|
| PubChem CID | 4261431 |
| Molecular Formula | C32H39N3O3 |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-N-(3-ethoxypropyl)-5-[(2-phenylacetyl)amino]benzamide |
| SMILES | CCOCCCNC(=O)c1cc(NC(=O)Cc2ccccc2)ccc1N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C32H39N3O3/c1-2-38-21-9-18-33-32(37)29-24-28(34-31(36)23-26-12-7-4-8-13-26)14-15-30(29)35-19-16-27(17-20-35)22-25-10-5-3-6-11-25/h3-8,10-15,24,27H,2,9,16-23H2,1H3,(H,33,37)(H,34,36) |
| InChIKey | NGRWASIJWCMDPH-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|