C27H38N4O3 — CID 4297190
2-(4-benzylpiperidin-1-yl)-5-(dimethylcarbamoylamino)-N-(3-ethoxypropyl)benzamide (PubChem CID 4297190) has the molecular formula C27H38N4O3 and a molecular weight of 466.63 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-5-(dimethylcarbamoylamino)-N-(3-ethoxypropyl)benzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-5-(dimethylcarbamoylamino)-N-(3-ethoxypropyl)benzamide |
|---|---|
| PubChem CID | 4297190 |
| Molecular Formula | C27H38N4O3 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-5-(dimethylcarbamoylamino)-N-(3-ethoxypropyl)benzamide |
| SMILES | CCOCCCNC(=O)c1cc(NC(=O)N(C)C)ccc1N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H38N4O3/c1-4-34-18-8-15-28-26(32)24-20-23(29-27(33)30(2)3)11-12-25(24)31-16-13-22(14-17-31)19-21-9-6-5-7-10-21/h5-7,9-12,20,22H,4,8,13-19H2,1-3H3,(H,28,32)(H,29,33) |
| InChIKey | KTAQDCQJJOEPMK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|