C19H30N4O3 — CID 42756162
5-(dimethylcarbamoylamino)-N-(3-ethoxypropyl)-2-pyrrolidin-1-ylbenzamide (PubChem CID 42756162) has the molecular formula C19H30N4O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is 5-(dimethylcarbamoylamino)-N-(3-ethoxypropyl)-2-pyrrolidin-1-ylbenzamide.
| Compound Name | 5-(dimethylcarbamoylamino)-N-(3-ethoxypropyl)-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 42756162 |
| Molecular Formula | C19H30N4O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | 5-(dimethylcarbamoylamino)-N-(3-ethoxypropyl)-2-pyrrolidin-1-ylbenzamide |
| SMILES | CCOCCCNC(=O)c1cc(NC(=O)N(C)C)ccc1N1CCCC1 |
| InChI | InChI=1S/C19H30N4O3/c1-4-26-13-7-10-20-18(24)16-14-15(21-19(25)22(2)3)8-9-17(16)23-11-5-6-12-23/h8-9,14H,4-7,10-13H2,1-3H3,(H,20,24)(H,21,25) |
| InChIKey | ODFLRVBLVONGCO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|