C24H29Cl2N3O3 — CID 42660675
5-[(3,5-dichlorobenzoyl)amino]-N-(3-ethoxypropyl)-2-piperidin-1-ylbenzamide (PubChem CID 42660675) has the molecular formula C24H29Cl2N3O3 and a molecular weight of 478.42 g/mol. Its IUPAC name is 5-[(3,5-dichlorobenzoyl)amino]-N-(3-ethoxypropyl)-2-piperidin-1-ylbenzamide.
| Compound Name | 5-[(3,5-dichlorobenzoyl)amino]-N-(3-ethoxypropyl)-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 42660675 |
| Molecular Formula | C24H29Cl2N3O3 |
| Molecular Weight | 478.42 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 5-[(3,5-dichlorobenzoyl)amino]-N-(3-ethoxypropyl)-2-piperidin-1-ylbenzamide |
| SMILES | CCOCCCNC(=O)c1cc(NC(=O)c2cc(Cl)cc(Cl)c2)ccc1N1CCCCC1 |
| InChI | InChI=1S/C24H29Cl2N3O3/c1-2-32-12-6-9-27-24(31)21-16-20(7-8-22(21)29-10-4-3-5-11-29)28-23(30)17-13-18(25)15-19(26)14-17/h7-8,13-16H,2-6,9-12H2,1H3,(H,27,31)(H,28,30) |
| InChIKey | FPIXJGQARBSFBX-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.42 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|