C20H31N3O4 — CID 3313832
N-(3-ethoxypropyl)-5-[(2-methoxyacetyl)amino]-2-piperidin-1-ylbenzamide (PubChem CID 3313832) has the molecular formula C20H31N3O4 and a molecular weight of 377.49 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-5-[(2-methoxyacetyl)amino]-2-piperidin-1-ylbenzamide.
| Compound Name | N-(3-ethoxypropyl)-5-[(2-methoxyacetyl)amino]-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 3313832 |
| Molecular Formula | C20H31N3O4 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | N-(3-ethoxypropyl)-5-[(2-methoxyacetyl)amino]-2-piperidin-1-ylbenzamide |
| SMILES | CCOCCCNC(=O)c1cc(NC(=O)COC)ccc1N1CCCCC1 |
| InChI | InChI=1S/C20H31N3O4/c1-3-27-13-7-10-21-20(25)17-14-16(22-19(24)15-26-2)8-9-18(17)23-11-5-4-6-12-23/h8-9,14H,3-7,10-13,15H2,1-2H3,(H,21,25)(H,22,24) |
| InChIKey | FRYFWBCUYSLFQQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|