C25H33ClN4O3 — CID 3895731
5-[(3-chloro-4-methylphenyl)carbamoylamino]-N-(3-ethoxypropyl)-2-piperidin-1-ylbenzamide (PubChem CID 3895731) has the molecular formula C25H33ClN4O3 and a molecular weight of 473.02 g/mol. Its IUPAC name is 5-[(3-chloro-4-methylphenyl)carbamoylamino]-N-(3-ethoxypropyl)-2-piperidin-1-ylbenzamide.
| Compound Name | 5-[(3-chloro-4-methylphenyl)carbamoylamino]-N-(3-ethoxypropyl)-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 3895731 |
| Molecular Formula | C25H33ClN4O3 |
| Molecular Weight | 473.02 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 5-[(3-chloro-4-methylphenyl)carbamoylamino]-N-(3-ethoxypropyl)-2-piperidin-1-ylbenzamide |
| SMILES | CCOCCCNC(=O)c1cc(NC(=O)Nc2ccc(C)c(Cl)c2)ccc1N1CCCCC1 |
| InChI | InChI=1S/C25H33ClN4O3/c1-3-33-15-7-12-27-24(31)21-16-19(10-11-23(21)30-13-5-4-6-14-30)28-25(32)29-20-9-8-18(2)22(26)17-20/h8-11,16-17H,3-7,12-15H2,1-2H3,(H,27,31)(H2,28,29,32) |
| InChIKey | WTWUEOQFIJRUKR-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.02 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|