C22H25Cl3N4O3 — CID 143368272
3-[[5-[(3,4-dichlorophenyl)carbamoylamino]-2-piperidin-1-ylbenzoyl]amino]propyl hypochlorite (PubChem CID 143368272) has the molecular formula C22H25Cl3N4O3 and a molecular weight of 499.83 g/mol. Its IUPAC name is 3-[[5-[(3,4-dichlorophenyl)carbamoylamino]-2-piperidin-1-ylbenzoyl]amino]propyl hypochlorite.
| Compound Name | 3-[[5-[(3,4-dichlorophenyl)carbamoylamino]-2-piperidin-1-ylbenzoyl]amino]propyl hypochlorite |
|---|---|
| PubChem CID | 143368272 |
| Molecular Formula | C22H25Cl3N4O3 |
| Molecular Weight | 499.83 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | 3-[[5-[(3,4-dichlorophenyl)carbamoylamino]-2-piperidin-1-ylbenzoyl]amino]propyl hypochlorite |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)Nc1ccc(N2CCCCC2)c(C(=O)NCCCOCl)c1 |
| InChI | InChI=1S/C22H25Cl3N4O3/c23-18-7-5-16(14-19(18)24)28-22(31)27-15-6-8-20(29-10-2-1-3-11-29)17(13-15)21(30)26-9-4-12-32-25/h5-8,13-14H,1-4,9-12H2,(H,26,30)(H2,27,28,31) |
| InChIKey | GNGNVLOQKAHHOY-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.83 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|