C21H23Cl2N3O3 — CID 4528462
3,4-dichloro-N-[3-(2-methoxyethylcarbamoyl)-4-pyrrolidin-1-ylphenyl]benzamide (PubChem CID 4528462) has the molecular formula C21H23Cl2N3O3 and a molecular weight of 436.34 g/mol. Its IUPAC name is 3,4-dichloro-N-[3-(2-methoxyethylcarbamoyl)-4-pyrrolidin-1-ylphenyl]benzamide.
| Compound Name | 3,4-dichloro-N-[3-(2-methoxyethylcarbamoyl)-4-pyrrolidin-1-ylphenyl]benzamide |
|---|---|
| PubChem CID | 4528462 |
| Molecular Formula | C21H23Cl2N3O3 |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 3,4-dichloro-N-[3-(2-methoxyethylcarbamoyl)-4-pyrrolidin-1-ylphenyl]benzamide |
| SMILES | COCCNC(=O)c1cc(NC(=O)c2ccc(Cl)c(Cl)c2)ccc1N1CCCC1 |
| InChI | InChI=1S/C21H23Cl2N3O3/c1-29-11-8-24-21(28)16-13-15(5-7-19(16)26-9-2-3-10-26)25-20(27)14-4-6-17(22)18(23)12-14/h4-7,12-13H,2-3,8-11H2,1H3,(H,24,28)(H,25,27) |
| InChIKey | FTYULSGLXNETQI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|