C23H23F6N3O3 — CID 5134042
5-[[3,5-bis(trifluoromethyl)benzoyl]amino]-N-(2-methoxyethyl)-2-pyrrolidin-1-ylbenzamide (PubChem CID 5134042) has the molecular formula C23H23F6N3O3 and a molecular weight of 503.44 g/mol. Its IUPAC name is 5-[[3,5-bis(trifluoromethyl)benzoyl]amino]-N-(2-methoxyethyl)-2-pyrrolidin-1-ylbenzamide.
| Compound Name | 5-[[3,5-bis(trifluoromethyl)benzoyl]amino]-N-(2-methoxyethyl)-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 5134042 |
| Molecular Formula | C23H23F6N3O3 |
| Molecular Weight | 503.44 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | 5-[[3,5-bis(trifluoromethyl)benzoyl]amino]-N-(2-methoxyethyl)-2-pyrrolidin-1-ylbenzamide |
| SMILES | COCCNC(=O)c1cc(NC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)ccc1N1CCCC1 |
| InChI | InChI=1S/C23H23F6N3O3/c1-35-9-6-30-21(34)18-13-17(4-5-19(18)32-7-2-3-8-32)31-20(33)14-10-15(22(24,25)26)12-16(11-14)23(27,28)29/h4-5,10-13H,2-3,6-9H2,1H3,(H,30,34)(H,31,33) |
| InChIKey | ZTTIYSJXXBMTGT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|