C25H29F3N4O3 — CID 42751288
N-(2-morpholin-4-ylethyl)-2-pyrrolidin-1-yl-5-[[4-(trifluoromethyl)benzoyl]amino]benzamide (PubChem CID 42751288) has the molecular formula C25H29F3N4O3 and a molecular weight of 490.53 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-2-pyrrolidin-1-yl-5-[[4-(trifluoromethyl)benzoyl]amino]benzamide.
| Compound Name | N-(2-morpholin-4-ylethyl)-2-pyrrolidin-1-yl-5-[[4-(trifluoromethyl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 42751288 |
| Molecular Formula | C25H29F3N4O3 |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-2-pyrrolidin-1-yl-5-[[4-(trifluoromethyl)benzoyl]amino]benzamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)c(C(=O)NCCN2CCOCC2)c1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H29F3N4O3/c26-25(27,28)19-5-3-18(4-6-19)23(33)30-20-7-8-22(32-10-1-2-11-32)21(17-20)24(34)29-9-12-31-13-15-35-16-14-31/h3-8,17H,1-2,9-16H2,(H,29,34)(H,30,33) |
| InChIKey | ZGAYFCXIYINVNM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|