C33H41N5O3 — CID 1063963
2-(4-benzylpiperazin-1-yl)-5-[(4-ethylbenzoyl)amino]-N-(2-morpholin-4-ylethyl)benzamide (PubChem CID 1063963) has the molecular formula C33H41N5O3 and a molecular weight of 555.72 g/mol. Its IUPAC name is 2-(4-benzylpiperazin-1-yl)-5-[(4-ethylbenzoyl)amino]-N-(2-morpholin-4-ylethyl)benzamide.
| Compound Name | 2-(4-benzylpiperazin-1-yl)-5-[(4-ethylbenzoyl)amino]-N-(2-morpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 1063963 |
| Molecular Formula | C33H41N5O3 |
| Molecular Weight | 555.72 g/mol |
| Exact Mass | 555.32 |
| IUPAC Name | 2-(4-benzylpiperazin-1-yl)-5-[(4-ethylbenzoyl)amino]-N-(2-morpholin-4-ylethyl)benzamide |
| SMILES | CCc1ccc(C(=O)Nc2ccc(N3CCN(Cc4ccccc4)CC3)c(C(=O)NCCN3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C33H41N5O3/c1-2-26-8-10-28(11-9-26)32(39)35-29-12-13-31(30(24-29)33(40)34-14-15-36-20-22-41-23-21-36)38-18-16-37(17-19-38)25-27-6-4-3-5-7-27/h3-13,24H,2,14-23,25H2,1H3,(H,34,40)(H,35,39) |
| InChIKey | FRTBJDZRTXGOPY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.72 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|