C35H36N4O3 — CID 1064004
2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-morpholin-4-ylethyl)-5-[(4-phenylbenzoyl)amino]benzamide (PubChem CID 1064004) has the molecular formula C35H36N4O3 and a molecular weight of 560.70 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-morpholin-4-ylethyl)-5-[(4-phenylbenzoyl)amino]benzamide.
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-morpholin-4-ylethyl)-5-[(4-phenylbenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 1064004 |
| Molecular Formula | C35H36N4O3 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-morpholin-4-ylethyl)-5-[(4-phenylbenzoyl)amino]benzamide |
| SMILES | O=C(Nc1ccc(N2CCc3ccccc3C2)c(C(=O)NCCN2CCOCC2)c1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C35H36N4O3/c40-34(29-12-10-28(11-13-29)26-6-2-1-3-7-26)37-31-14-15-33(39-18-16-27-8-4-5-9-30(27)25-39)32(24-31)35(41)36-17-19-38-20-22-42-23-21-38/h1-15,24H,16-23,25H2,(H,36,41)(H,37,40) |
| InChIKey | KWAAJNBEWIAUOT-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|