C30H33N5O5 — CID 42659455
2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(3-morpholin-4-ylpropyl)-5-[(4-nitrobenzoyl)amino]benzamide (PubChem CID 42659455) has the molecular formula C30H33N5O5 and a molecular weight of 543.62 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(3-morpholin-4-ylpropyl)-5-[(4-nitrobenzoyl)amino]benzamide.
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(3-morpholin-4-ylpropyl)-5-[(4-nitrobenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 42659455 |
| Molecular Formula | C30H33N5O5 |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(3-morpholin-4-ylpropyl)-5-[(4-nitrobenzoyl)amino]benzamide |
| SMILES | O=C(Nc1ccc(N2CCc3ccccc3C2)c(C(=O)NCCCN2CCOCC2)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H33N5O5/c36-29(23-6-9-26(10-7-23)35(38)39)32-25-8-11-28(34-15-12-22-4-1-2-5-24(22)21-34)27(20-25)30(37)31-13-3-14-33-16-18-40-19-17-33/h1-2,4-11,20H,3,12-19,21H2,(H,31,37)(H,32,36) |
| InChIKey | RXJAIZSZTGWAQD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 117.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|