C29H33N5O4 — CID 4286562
N-[2-(diethylamino)ethyl]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[(4-nitrobenzoyl)amino]benzamide (PubChem CID 4286562) has the molecular formula C29H33N5O4 and a molecular weight of 515.61 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[(4-nitrobenzoyl)amino]benzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[(4-nitrobenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 4286562 |
| Molecular Formula | C29H33N5O4 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.25 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[(4-nitrobenzoyl)amino]benzamide |
| SMILES | CCN(CC)CCNC(=O)c1cc(NC(=O)c2ccc([N+](=O)[O-])cc2)ccc1N1CCc2ccccc2C1 |
| InChI | InChI=1S/C29H33N5O4/c1-3-32(4-2)18-16-30-29(36)26-19-24(31-28(35)22-9-12-25(13-10-22)34(37)38)11-14-27(26)33-17-15-21-7-5-6-8-23(21)20-33/h5-14,19H,3-4,15-18,20H2,1-2H3,(H,30,36)(H,31,35) |
| InChIKey | BQSQUAMIEHEJGJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|