C28H28F3N3O3 — CID 3989327
2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(3-methoxypropyl)-5-[[4-(trifluoromethyl)benzoyl]amino]benzamide (PubChem CID 3989327) has the molecular formula C28H28F3N3O3 and a molecular weight of 511.54 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(3-methoxypropyl)-5-[[4-(trifluoromethyl)benzoyl]amino]benzamide.
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(3-methoxypropyl)-5-[[4-(trifluoromethyl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 3989327 |
| Molecular Formula | C28H28F3N3O3 |
| Molecular Weight | 511.54 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(3-methoxypropyl)-5-[[4-(trifluoromethyl)benzoyl]amino]benzamide |
| SMILES | COCCCNC(=O)c1cc(NC(=O)c2ccc(C(F)(F)F)cc2)ccc1N1CCc2ccccc2C1 |
| InChI | InChI=1S/C28H28F3N3O3/c1-37-16-4-14-32-27(36)24-17-23(33-26(35)20-7-9-22(10-8-20)28(29,30)31)11-12-25(24)34-15-13-19-5-2-3-6-21(19)18-34/h2-3,5-12,17H,4,13-16,18H2,1H3,(H,32,36)(H,33,35) |
| InChIKey | XAIBBUJYNMLJGJ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.54 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|