C28H31N3O4 — CID 3968454
2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(3-methoxypropyl)-5-[(2-phenoxyacetyl)amino]benzamide (PubChem CID 3968454) has the molecular formula C28H31N3O4 and a molecular weight of 473.57 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(3-methoxypropyl)-5-[(2-phenoxyacetyl)amino]benzamide.
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(3-methoxypropyl)-5-[(2-phenoxyacetyl)amino]benzamide |
|---|---|
| PubChem CID | 3968454 |
| Molecular Formula | C28H31N3O4 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(3-methoxypropyl)-5-[(2-phenoxyacetyl)amino]benzamide |
| SMILES | COCCCNC(=O)c1cc(NC(=O)COc2ccccc2)ccc1N1CCc2ccccc2C1 |
| InChI | InChI=1S/C28H31N3O4/c1-34-17-7-15-29-28(33)25-18-23(30-27(32)20-35-24-10-3-2-4-11-24)12-13-26(25)31-16-14-21-8-5-6-9-22(21)19-31/h2-6,8-13,18H,7,14-17,19-20H2,1H3,(H,29,33)(H,30,32) |
| InChIKey | LUGBTWGOYCIYRX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|