C32H31N3O3 — CID 1066393
2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[(2-methoxybenzoyl)amino]-N-(2-phenylethyl)benzamide (PubChem CID 1066393) has the molecular formula C32H31N3O3 and a molecular weight of 505.62 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[(2-methoxybenzoyl)amino]-N-(2-phenylethyl)benzamide.
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[(2-methoxybenzoyl)amino]-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 1066393 |
| Molecular Formula | C32H31N3O3 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[(2-methoxybenzoyl)amino]-N-(2-phenylethyl)benzamide |
| SMILES | COc1ccccc1C(=O)Nc1ccc(N2CCc3ccccc3C2)c(C(=O)NCCc2ccccc2)c1 |
| InChI | InChI=1S/C32H31N3O3/c1-38-30-14-8-7-13-27(30)32(37)34-26-15-16-29(35-20-18-24-11-5-6-12-25(24)22-35)28(21-26)31(36)33-19-17-23-9-3-2-4-10-23/h2-16,21H,17-20,22H2,1H3,(H,33,36)(H,34,37) |
| InChIKey | NKZJPUKNQQBBHX-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|