C31H28BrN3O2 — CID 3929280
5-[(3-bromobenzoyl)amino]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-phenylethyl)benzamide (PubChem CID 3929280) has the molecular formula C31H28BrN3O2 and a molecular weight of 554.49 g/mol. Its IUPAC name is 5-[(3-bromobenzoyl)amino]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-phenylethyl)benzamide.
| Compound Name | 5-[(3-bromobenzoyl)amino]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 3929280 |
| Molecular Formula | C31H28BrN3O2 |
| Molecular Weight | 554.49 g/mol |
| Exact Mass | 553.14 |
| IUPAC Name | 5-[(3-bromobenzoyl)amino]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-phenylethyl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCc3ccccc3C2)c(C(=O)NCCc2ccccc2)c1)c1cccc(Br)c1 |
| InChI | InChI=1S/C31H28BrN3O2/c32-26-12-6-11-24(19-26)30(36)34-27-13-14-29(35-18-16-23-9-4-5-10-25(23)21-35)28(20-27)31(37)33-17-15-22-7-2-1-3-8-22/h1-14,19-20H,15-18,21H2,(H,33,37)(H,34,36) |
| InChIKey | CCXKMMHMSUTHMT-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.49 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|