C32H39N3O2 — CID 3663772
2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-methylpropyl)-5-[(4-pentylbenzoyl)amino]benzamide (PubChem CID 3663772) has the molecular formula C32H39N3O2 and a molecular weight of 497.68 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-methylpropyl)-5-[(4-pentylbenzoyl)amino]benzamide.
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-methylpropyl)-5-[(4-pentylbenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 3663772 |
| Molecular Formula | C32H39N3O2 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.30 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-methylpropyl)-5-[(4-pentylbenzoyl)amino]benzamide |
| SMILES | CCCCCc1ccc(C(=O)Nc2ccc(N3CCc4ccccc4C3)c(C(=O)NCC(C)C)c2)cc1 |
| InChI | InChI=1S/C32H39N3O2/c1-4-5-6-9-24-12-14-26(15-13-24)31(36)34-28-16-17-30(29(20-28)32(37)33-21-23(2)3)35-19-18-25-10-7-8-11-27(25)22-35/h7-8,10-17,20,23H,4-6,9,18-19,21-22H2,1-3H3,(H,33,37)(H,34,36) |
| InChIKey | KRRGKZAGVXMZKS-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|