C26H35N3O2 — CID 3951145
2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-(hexanoylamino)-N-(2-methylpropyl)benzamide (PubChem CID 3951145) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-(hexanoylamino)-N-(2-methylpropyl)benzamide.
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-(hexanoylamino)-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 3951145 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-(hexanoylamino)-N-(2-methylpropyl)benzamide |
| SMILES | CCCCCC(=O)Nc1ccc(N2CCc3ccccc3C2)c(C(=O)NCC(C)C)c1 |
| InChI | InChI=1S/C26H35N3O2/c1-4-5-6-11-25(30)28-22-12-13-24(23(16-22)26(31)27-17-19(2)3)29-15-14-20-9-7-8-10-21(20)18-29/h7-10,12-13,16,19H,4-6,11,14-15,17-18H2,1-3H3,(H,27,31)(H,28,30) |
| InChIKey | BJHHZSYZDDDLCX-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|