C27H30N4O2 — CID 42762511
2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-(pentanoylamino)-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 42762511) has the molecular formula C27H30N4O2 and a molecular weight of 442.56 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-(pentanoylamino)-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-(pentanoylamino)-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 42762511 |
| Molecular Formula | C27H30N4O2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-(pentanoylamino)-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | CCCCC(=O)Nc1ccc(N2CCc3ccccc3C2)c(C(=O)NCc2cccnc2)c1 |
| InChI | InChI=1S/C27H30N4O2/c1-2-3-10-26(32)30-23-11-12-25(31-15-13-21-8-4-5-9-22(21)19-31)24(16-23)27(33)29-18-20-7-6-14-28-17-20/h4-9,11-12,14,16-17H,2-3,10,13,15,18-19H2,1H3,(H,29,33)(H,30,32) |
| InChIKey | BVTIZMXOFCJYBO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|