C35H39N5O2 — CID 4676984
2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 4676984) has the molecular formula C35H39N5O2 and a molecular weight of 561.73 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 4676984 |
| Molecular Formula | C35H39N5O2 |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.31 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)Nc1ccc(N2CCc3ccccc3C2)c(C(=O)NCc2cccnc2)c1 |
| InChI | InChI=1S/C35H39N5O2/c1-23(2)29-12-7-13-30(24(3)4)33(29)39-35(42)38-28-14-15-32(40-18-16-26-10-5-6-11-27(26)22-40)31(19-28)34(41)37-21-25-9-8-17-36-20-25/h5-15,17,19-20,23-24H,16,18,21-22H2,1-4H3,(H,37,41)(H2,38,39,42) |
| InChIKey | RODFHROUMXJCMH-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|