C28H30N4O2 — CID 42762524
5-(cyclopentanecarbonylamino)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 42762524) has the molecular formula C28H30N4O2 and a molecular weight of 454.57 g/mol. Its IUPAC name is 5-(cyclopentanecarbonylamino)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 5-(cyclopentanecarbonylamino)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 42762524 |
| Molecular Formula | C28H30N4O2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | 5-(cyclopentanecarbonylamino)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | O=C(NCc1cccnc1)c1cc(NC(=O)C2CCCC2)ccc1N1CCc2ccccc2C1 |
| InChI | InChI=1S/C28H30N4O2/c33-27(22-8-2-3-9-22)31-24-11-12-26(32-15-13-21-7-1-4-10-23(21)19-32)25(16-24)28(34)30-18-20-6-5-14-29-17-20/h1,4-7,10-12,14,16-17,22H,2-3,8-9,13,15,18-19H2,(H,30,34)(H,31,33) |
| InChIKey | BBTMJCYJTWVXOK-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|