C25H24Cl2N4O2 — CID 1055057
5-[(3,5-dichlorobenzoyl)amino]-2-piperidin-1-yl-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 1055057) has the molecular formula C25H24Cl2N4O2 and a molecular weight of 483.40 g/mol. Its IUPAC name is 5-[(3,5-dichlorobenzoyl)amino]-2-piperidin-1-yl-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 5-[(3,5-dichlorobenzoyl)amino]-2-piperidin-1-yl-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 1055057 |
| Molecular Formula | C25H24Cl2N4O2 |
| Molecular Weight | 483.40 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 5-[(3,5-dichlorobenzoyl)amino]-2-piperidin-1-yl-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)c(C(=O)NCc2cccnc2)c1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C25H24Cl2N4O2/c26-19-11-18(12-20(27)13-19)24(32)30-21-6-7-23(31-9-2-1-3-10-31)22(14-21)25(33)29-16-17-5-4-8-28-15-17/h4-8,11-15H,1-3,9-10,16H2,(H,29,33)(H,30,32) |
| InChIKey | KOPKBWNHBJNSNA-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.40 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|