C24H23ClFN5O2 — CID 42756386
5-[(3-chloro-4-fluorophenyl)carbamoylamino]-N-(pyridin-3-ylmethyl)-2-pyrrolidin-1-ylbenzamide (PubChem CID 42756386) has the molecular formula C24H23ClFN5O2 and a molecular weight of 467.93 g/mol. Its IUPAC name is 5-[(3-chloro-4-fluorophenyl)carbamoylamino]-N-(pyridin-3-ylmethyl)-2-pyrrolidin-1-ylbenzamide.
| Compound Name | 5-[(3-chloro-4-fluorophenyl)carbamoylamino]-N-(pyridin-3-ylmethyl)-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 42756386 |
| Molecular Formula | C24H23ClFN5O2 |
| Molecular Weight | 467.93 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 5-[(3-chloro-4-fluorophenyl)carbamoylamino]-N-(pyridin-3-ylmethyl)-2-pyrrolidin-1-ylbenzamide |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)Nc1ccc(N2CCCC2)c(C(=O)NCc2cccnc2)c1 |
| InChI | InChI=1S/C24H23ClFN5O2/c25-20-13-18(5-7-21(20)26)30-24(33)29-17-6-8-22(31-10-1-2-11-31)19(12-17)23(32)28-15-16-4-3-9-27-14-16/h3-9,12-14H,1-2,10-11,15H2,(H,28,32)(H2,29,30,33) |
| InChIKey | FTLLNVLQDJWZOI-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.93 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|