C26H25F3N4O2 — CID 42755646
2-piperidin-1-yl-N-(pyridin-3-ylmethyl)-5-[[4-(trifluoromethyl)benzoyl]amino]benzamide (PubChem CID 42755646) has the molecular formula C26H25F3N4O2 and a molecular weight of 482.51 g/mol. Its IUPAC name is 2-piperidin-1-yl-N-(pyridin-3-ylmethyl)-5-[[4-(trifluoromethyl)benzoyl]amino]benzamide.
| Compound Name | 2-piperidin-1-yl-N-(pyridin-3-ylmethyl)-5-[[4-(trifluoromethyl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 42755646 |
| Molecular Formula | C26H25F3N4O2 |
| Molecular Weight | 482.51 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 2-piperidin-1-yl-N-(pyridin-3-ylmethyl)-5-[[4-(trifluoromethyl)benzoyl]amino]benzamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)c(C(=O)NCc2cccnc2)c1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H25F3N4O2/c27-26(28,29)20-8-6-19(7-9-20)24(34)32-21-10-11-23(33-13-2-1-3-14-33)22(15-21)25(35)31-17-18-5-4-12-30-16-18/h4-12,15-16H,1-3,13-14,17H2,(H,31,35)(H,32,34) |
| InChIKey | RGJTXRJUMMMLBA-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|