C25H25FN4O2 — CID 1055044
5-[(2-fluorobenzoyl)amino]-2-piperidin-1-yl-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 1055044) has the molecular formula C25H25FN4O2 and a molecular weight of 432.50 g/mol. Its IUPAC name is 5-[(2-fluorobenzoyl)amino]-2-piperidin-1-yl-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 5-[(2-fluorobenzoyl)amino]-2-piperidin-1-yl-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 1055044 |
| Molecular Formula | C25H25FN4O2 |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 5-[(2-fluorobenzoyl)amino]-2-piperidin-1-yl-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)c(C(=O)NCc2cccnc2)c1)c1ccccc1F |
| InChI | InChI=1S/C25H25FN4O2/c26-22-9-3-2-8-20(22)25(32)29-19-10-11-23(30-13-4-1-5-14-30)21(15-19)24(31)28-17-18-7-6-12-27-16-18/h2-3,6-12,15-16H,1,4-5,13-14,17H2,(H,28,31)(H,29,32) |
| InChIKey | RGTYGNPDQASQQK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|