C25H24F3N5O2 — CID 1065660
N-(pyridin-3-ylmethyl)-2-pyrrolidin-1-yl-5-[[2-(trifluoromethyl)phenyl]carbamoylamino]benzamide (PubChem CID 1065660) has the molecular formula C25H24F3N5O2 and a molecular weight of 483.49 g/mol. Its IUPAC name is N-(pyridin-3-ylmethyl)-2-pyrrolidin-1-yl-5-[[2-(trifluoromethyl)phenyl]carbamoylamino]benzamide.
| Compound Name | N-(pyridin-3-ylmethyl)-2-pyrrolidin-1-yl-5-[[2-(trifluoromethyl)phenyl]carbamoylamino]benzamide |
|---|---|
| PubChem CID | 1065660 |
| Molecular Formula | C25H24F3N5O2 |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | N-(pyridin-3-ylmethyl)-2-pyrrolidin-1-yl-5-[[2-(trifluoromethyl)phenyl]carbamoylamino]benzamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)c(C(=O)NCc2cccnc2)c1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C25H24F3N5O2/c26-25(27,28)20-7-1-2-8-21(20)32-24(35)31-18-9-10-22(33-12-3-4-13-33)19(14-18)23(34)30-16-17-6-5-11-29-15-17/h1-2,5-11,14-15H,3-4,12-13,16H2,(H,30,34)(H2,31,32,35) |
| InChIKey | JCHZOQHDKZKOPK-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|