C25H34N4O2 — CID 7213668
5-[[(2R)-2-ethylhexanoyl]amino]-N-(pyridin-3-ylmethyl)-2-pyrrolidin-1-ylbenzamide (PubChem CID 7213668) has the molecular formula C25H34N4O2 and a molecular weight of 422.57 g/mol. Its IUPAC name is 5-[[(2R)-2-ethylhexanoyl]amino]-N-(pyridin-3-ylmethyl)-2-pyrrolidin-1-ylbenzamide.
| Compound Name | 5-[[(2R)-2-ethylhexanoyl]amino]-N-(pyridin-3-ylmethyl)-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 7213668 |
| Molecular Formula | C25H34N4O2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 5-[[(2R)-2-ethylhexanoyl]amino]-N-(pyridin-3-ylmethyl)-2-pyrrolidin-1-ylbenzamide |
| SMILES | CCCCC(CC)C(=O)Nc1ccc(N2CCCC2)c(C(=O)NCc2cccnc2)c1 |
| InChI | InChI=1S/C25H34N4O2/c1-3-5-10-20(4-2)24(30)28-21-11-12-23(29-14-6-7-15-29)22(16-21)25(31)27-18-19-9-8-13-26-17-19/h8-9,11-13,16-17,20H,3-7,10,14-15,18H2,1-2H3,(H,27,31)(H,28,30) |
| InChIKey | YNKYHPHGZVSIJH-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|