C24H39N3O2 — CID 7230917
N-[(2R)-butan-2-yl]-5-[[(2R)-2-ethylhexanoyl]amino]-2-piperidin-1-ylbenzamide (PubChem CID 7230917) has the molecular formula C24H39N3O2 and a molecular weight of 401.60 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-5-[[(2R)-2-ethylhexanoyl]amino]-2-piperidin-1-ylbenzamide.
| Compound Name | N-[(2R)-butan-2-yl]-5-[[(2R)-2-ethylhexanoyl]amino]-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 7230917 |
| Molecular Formula | C24H39N3O2 |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.30 |
| IUPAC Name | N-[(2R)-butan-2-yl]-5-[[(2R)-2-ethylhexanoyl]amino]-2-piperidin-1-ylbenzamide |
| SMILES | CCCCC(CC)C(=O)Nc1ccc(N2CCCCC2)c(C(=O)N[C@H](C)CC)c1 |
| InChI | InChI=1S/C24H39N3O2/c1-5-8-12-19(7-3)23(28)26-20-13-14-22(27-15-10-9-11-16-27)21(17-20)24(29)25-18(4)6-2/h13-14,17-19H,5-12,15-16H2,1-4H3,(H,25,29)(H,26,28)/t18-,19?/m1/s1 |
| InChIKey | FNDFEFZYOHOPSW-MRTLOADZSA-N |
| XLogP | 5.36 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|