C31H39N5O2 — CID 42756268
5-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]-2-piperidin-1-yl-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 42756268) has the molecular formula C31H39N5O2 and a molecular weight of 513.69 g/mol. Its IUPAC name is 5-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]-2-piperidin-1-yl-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 5-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]-2-piperidin-1-yl-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 42756268 |
| Molecular Formula | C31H39N5O2 |
| Molecular Weight | 513.69 g/mol |
| Exact Mass | 513.31 |
| IUPAC Name | 5-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]-2-piperidin-1-yl-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)Nc1ccc(N2CCCCC2)c(C(=O)NCc2cccnc2)c1 |
| InChI | InChI=1S/C31H39N5O2/c1-21(2)25-11-8-12-26(22(3)4)29(25)35-31(38)34-24-13-14-28(36-16-6-5-7-17-36)27(18-24)30(37)33-20-23-10-9-15-32-19-23/h8-15,18-19,21-22H,5-7,16-17,20H2,1-4H3,(H,33,37)(H2,34,35,38) |
| InChIKey | ZJGBQSOQOZRWAV-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.69 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|