C29H40N4O2 — CID 5140990
1-[2,6-di(propan-2-yl)phenyl]-3-[3-(piperidine-1-carbonyl)-4-pyrrolidin-1-ylphenyl]urea (PubChem CID 5140990) has the molecular formula C29H40N4O2 and a molecular weight of 476.67 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-[3-(piperidine-1-carbonyl)-4-pyrrolidin-1-ylphenyl]urea.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[3-(piperidine-1-carbonyl)-4-pyrrolidin-1-ylphenyl]urea |
|---|---|
| PubChem CID | 5140990 |
| Molecular Formula | C29H40N4O2 |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.32 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[3-(piperidine-1-carbonyl)-4-pyrrolidin-1-ylphenyl]urea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)Nc1ccc(N2CCCC2)c(C(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C29H40N4O2/c1-20(2)23-11-10-12-24(21(3)4)27(23)31-29(35)30-22-13-14-26(32-15-8-9-16-32)25(19-22)28(34)33-17-6-5-7-18-33/h10-14,19-21H,5-9,15-18H2,1-4H3,(H2,30,31,35) |
| InChIKey | GEMAAWLYHJOVKG-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|