C23H27BrN4O2 — CID 1064177
1-(2-bromophenyl)-3-[3-(piperidine-1-carbonyl)-4-pyrrolidin-1-ylphenyl]urea (PubChem CID 1064177) has the molecular formula C23H27BrN4O2 and a molecular weight of 471.40 g/mol. Its IUPAC name is 1-(2-bromophenyl)-3-[3-(piperidine-1-carbonyl)-4-pyrrolidin-1-ylphenyl]urea.
| Compound Name | 1-(2-bromophenyl)-3-[3-(piperidine-1-carbonyl)-4-pyrrolidin-1-ylphenyl]urea |
|---|---|
| PubChem CID | 1064177 |
| Molecular Formula | C23H27BrN4O2 |
| Molecular Weight | 471.40 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 1-(2-bromophenyl)-3-[3-(piperidine-1-carbonyl)-4-pyrrolidin-1-ylphenyl]urea |
| SMILES | O=C(Nc1ccc(N2CCCC2)c(C(=O)N2CCCCC2)c1)Nc1ccccc1Br |
| InChI | InChI=1S/C23H27BrN4O2/c24-19-8-2-3-9-20(19)26-23(30)25-17-10-11-21(27-12-6-7-13-27)18(16-17)22(29)28-14-4-1-5-15-28/h2-3,8-11,16H,1,4-7,12-15H2,(H2,25,26,30) |
| InChIKey | ZOEOTNCOQHFTEP-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.40 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|