C18H23Cl2N3O2 — CID 1063786
2,2-dichloro-N-[3-(piperidine-1-carbonyl)-4-pyrrolidin-1-ylphenyl]acetamide (PubChem CID 1063786) has the molecular formula C18H23Cl2N3O2 and a molecular weight of 384.31 g/mol. Its IUPAC name is 2,2-dichloro-N-[3-(piperidine-1-carbonyl)-4-pyrrolidin-1-ylphenyl]acetamide.
| Compound Name | 2,2-dichloro-N-[3-(piperidine-1-carbonyl)-4-pyrrolidin-1-ylphenyl]acetamide |
|---|---|
| PubChem CID | 1063786 |
| Molecular Formula | C18H23Cl2N3O2 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 2,2-dichloro-N-[3-(piperidine-1-carbonyl)-4-pyrrolidin-1-ylphenyl]acetamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)c(C(=O)N2CCCCC2)c1)C(Cl)Cl |
| InChI | InChI=1S/C18H23Cl2N3O2/c19-16(20)17(24)21-13-6-7-15(22-8-4-5-9-22)14(12-13)18(25)23-10-2-1-3-11-23/h6-7,12,16H,1-5,8-11H2,(H,21,24) |
| InChIKey | KOIHGVMEIMFFPH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|